C35H38N2Si — CID 176802716
10-(2,2-dimethylpropyl)-17-(1,1-dimethylsilinan-4-yl)-12,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene (PubChem CID 176802716) has the molecular formula C35H38N2Si and a molecular weight of 514.79 g/mol. Its IUPAC name is 10-(2,2-dimethylpropyl)-17-(1,1-dimethylsilinan-4-yl)-12,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 10-(2,2-dimethylpropyl)-17-(1,1-dimethylsilinan-4-yl)-12,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 176802716 |
| Molecular Formula | C35H38N2Si |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 10-(2,2-dimethylpropyl)-17-(1,1-dimethylsilinan-4-yl)-12,24-diazahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14,16,18,20,22-dodecaene |
| SMILES | CC(C)(C)Cc1c2c(cc3ccccc13)-c1nccc3c1c(cc1cc(C4CC[Si](C)(C)CC4)ccc13)N2 |
| InChI | InChI=1S/C35H38N2Si/c1-35(2,3)21-30-26-9-7-6-8-24(26)19-29-33(30)37-31-20-25-18-23(22-13-16-38(4,5)17-14-22)10-11-27(25)28-12-15-36-34(29)32(28)31/h6-12,15,18-20,22,37H,13-14,16-17,21H2,1-5H3 |
| InChIKey | GUEABVSOQVHUDR-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|