C22H23F5N8O — CID 176803778
6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-4-methoxy-5-[3-[(2S)-1,1,1-trifluoropropan-2-yl]benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 176803778) has the molecular formula C22H23F5N8O and a molecular weight of 510.47 g/mol. Its IUPAC name is 6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-4-methoxy-5-[3-[(2S)-1,1,1-trifluoropropan-2-yl]benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-4-methoxy-5-[3-[(2S)-1,1,1-trifluoropropan-2-yl]benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 176803778 |
| Molecular Formula | C22H23F5N8O |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-4-methoxy-5-[3-[(2S)-1,1,1-trifluoropropan-2-yl]benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N)nn2cc([C@H]3CCN(C)CC3(F)F)c(-c3ccc4nnn([C@@H](C)C(F)(F)F)c4c3)c12 |
| InChI | InChI=1S/C22H23F5N8O/c1-11(22(25,26)27)35-16-8-12(4-5-15(16)30-32-35)17-13(14-6-7-33(2)10-21(14,23)24)9-34-18(17)19(36-3)29-20(28)31-34/h4-5,8-9,11,14H,6-7,10H2,1-3H3,(H2,28,31)/t11-,14+/m0/s1 |
| InChIKey | NZCCRTZEAAOESF-SMDDNHRTSA-N |
| XLogP | 3.91 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |