C24H25F5N8O2 — CID 176803684
7-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-[3-[(2R)-1,1-difluoropropan-2-yl]benzotriazol-5-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 176803684) has the molecular formula C24H25F5N8O2 and a molecular weight of 552.51 g/mol. Its IUPAC name is 7-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-[3-[(2R)-1,1-difluoropropan-2-yl]benzotriazol-5-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-[3-[(2R)-1,1-difluoropropan-2-yl]benzotriazol-5-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 176803684 |
| Molecular Formula | C24H25F5N8O2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 7-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-[3-[(2R)-1,1-difluoropropan-2-yl]benzotriazol-5-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N)nn2c([C@H]3CCN(C4COC4)CC3(F)F)c(F)c(-c3ccc4nnn([C@H](C)C(F)F)c4c3)c12 |
| InChI | InChI=1S/C24H25F5N8O2/c1-11(21(26)27)36-16-7-12(3-4-15(16)32-34-36)17-18(25)19(37-20(17)22(38-2)31-23(30)33-37)14-5-6-35(10-24(14,28)29)13-8-39-9-13/h3-4,7,11,13-14,21H,5-6,8-10H2,1-2H3,(H2,30,33)/t11-,14-/m1/s1 |
| InChIKey | WSKZYRZPYZDCRG-BXUZGUMPSA-N |
| XLogP | 3.52 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |