C31H35N4O6PS — CID 176807612
[2-[[(1R,2S,4R,7S,10S)-4-methyl-8-oxo-10-(3-pyridin-3-ylazetidine-1-carbonyl)-9-azatricyclo[7.3.0.02,4]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid (PubChem CID 176807612) has the molecular formula C31H35N4O6PS and a molecular weight of 622.68 g/mol. Its IUPAC name is [2-[[(1R,2S,4R,7S,10S)-4-methyl-8-oxo-10-(3-pyridin-3-ylazetidine-1-carbonyl)-9-azatricyclo[7.3.0.02,4]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid.
| Compound Name | [2-[[(1R,2S,4R,7S,10S)-4-methyl-8-oxo-10-(3-pyridin-3-ylazetidine-1-carbonyl)-9-azatricyclo[7.3.0.02,4]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 176807612 |
| Molecular Formula | C31H35N4O6PS |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | [2-[[(1R,2S,4R,7S,10S)-4-methyl-8-oxo-10-(3-pyridin-3-ylazetidine-1-carbonyl)-9-azatricyclo[7.3.0.02,4]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid |
| SMILES | C[C@]12CC[C@H](NC(=O)c3cc4cc(CP(=O)(O)O)ccc4s3)C(=O)N3[C@H](CC[C@H]3C(=O)N3CC(c4cccnc4)C3)[C@H]1C2 |
| InChI | InChI=1S/C31H35N4O6PS/c1-31-9-8-23(33-28(36)27-12-20-11-18(17-42(39,40)41)4-7-26(20)43-27)29(37)35-24(22(31)13-31)5-6-25(35)30(38)34-15-21(16-34)19-3-2-10-32-14-19/h2-4,7,10-12,14,21-25H,5-6,8-9,13,15-17H2,1H3,(H,33,36)(H2,39,40,41)/t22-,23+,24-,25+,31-/m1/s1 |
| InChIKey | PRVWPTUYPAWNRW-PUHQJUCYSA-N |
| XLogP | 3.88 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|