C42H81N3O6S3 — CID 176807946
2-hexylsulfanylethyl 4-[4-[2-[bis[4-(2-hexylsulfanylethoxy)-4-oxobutyl]amino]ethyl]piperazin-1-yl]butanoate (PubChem CID 176807946) has the molecular formula C42H81N3O6S3 and a molecular weight of 820.33 g/mol. Its IUPAC name is 2-hexylsulfanylethyl 4-[4-[2-[bis[4-(2-hexylsulfanylethoxy)-4-oxobutyl]amino]ethyl]piperazin-1-yl]butanoate.
| Compound Name | 2-hexylsulfanylethyl 4-[4-[2-[bis[4-(2-hexylsulfanylethoxy)-4-oxobutyl]amino]ethyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 176807946 |
| Molecular Formula | C42H81N3O6S3 |
| Molecular Weight | 820.33 g/mol |
| Exact Mass | 819.53 |
| IUPAC Name | 2-hexylsulfanylethyl 4-[4-[2-[bis[4-(2-hexylsulfanylethoxy)-4-oxobutyl]amino]ethyl]piperazin-1-yl]butanoate |
| SMILES | CCCCCCSCCOC(=O)CCCN(CCCC(=O)OCCSCCCCCC)CCN1CCN(CCCC(=O)OCCSCCCCCC)CC1 |
| InChI | InChI=1S/C42H81N3O6S3/c1-4-7-10-13-34-52-37-31-49-40(46)19-16-22-43(23-17-20-41(47)50-32-38-53-35-14-11-8-5-2)25-28-45-29-26-44(27-30-45)24-18-21-42(48)51-33-39-54-36-15-12-9-6-3/h4-39H2,1-3H3 |
| InChIKey | CKKHTDLJKOCMJK-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.33 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|