C10H15NO4 — CID 176808924
7,7-bis(hydroxymethyl)-2-azaspiro[3.5]nonane-1,3-dione (PubChem CID 176808924) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 7,7-bis(hydroxymethyl)-2-azaspiro[3.5]nonane-1,3-dione.
| Compound Name | 7,7-bis(hydroxymethyl)-2-azaspiro[3.5]nonane-1,3-dione |
|---|---|
| PubChem CID | 176808924 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 7,7-bis(hydroxymethyl)-2-azaspiro[3.5]nonane-1,3-dione |
| SMILES | O=C1NC(=O)C12CCC(CO)(CO)CC2 |
| InChI | InChI=1S/C10H15NO4/c12-5-9(6-13)1-3-10(4-2-9)7(14)11-8(10)15/h12-13H,1-6H2,(H,11,14,15) |
| InChIKey | IBWYBVYHZHBIIL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|