C35H45BFN5O6 — CID 176811874
tert-butyl 5-[5-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 176811874) has the molecular formula C35H45BFN5O6 and a molecular weight of 661.58 g/mol. Its IUPAC name is tert-butyl 5-[5-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[5-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 176811874 |
| Molecular Formula | C35H45BFN5O6 |
| Molecular Weight | 661.58 g/mol |
| Exact Mass | 661.34 |
| IUPAC Name | tert-butyl 5-[5-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COc1cc(F)cnc1N1CCN(C(=O)c2cc(B3OC(C)(C)C(C)(C)O3)c3[nH]c(C4=CCCN(C(=O)OC(C)(C)C)C4)cc3c2)CC1 |
| InChI | InChI=1S/C35H45BFN5O6/c1-33(2,3)46-32(44)42-11-9-10-22(21-42)27-18-23-16-24(17-26(29(23)39-27)36-47-34(4,5)35(6,7)48-36)31(43)41-14-12-40(13-15-41)30-28(45-8)19-25(37)20-38-30/h10,16-20,39H,9,11-15,21H2,1-8H3 |
| InChIKey | MNXOCNZJCVYGKY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|