C32H43BFN5O5 — CID 177171524
tert-butyl 5-[2-[(3Z)-3-(aminomethylidene)-4-ethyliminopyrrolidine-1-carbonyl]-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 177171524) has the molecular formula C32H43BFN5O5 and a molecular weight of 607.54 g/mol. Its IUPAC name is tert-butyl 5-[2-[(3Z)-3-(aminomethylidene)-4-ethyliminopyrrolidine-1-carbonyl]-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[(3Z)-3-(aminomethylidene)-4-ethyliminopyrrolidine-1-carbonyl]-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 177171524 |
| Molecular Formula | C32H43BFN5O5 |
| Molecular Weight | 607.54 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | tert-butyl 5-[2-[(3Z)-3-(aminomethylidene)-4-ethyliminopyrrolidine-1-carbonyl]-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC/N=C1/CN(C(=O)c2cc3c(B4OC(C)(C)C(C)(C)O4)cc(C4=CCCN(C(=O)OC(C)(C)C)C4)c(F)c3[nH]2)C/C1=C/N |
| InChI | InChI=1S/C32H43BFN5O5/c1-9-36-25-18-39(17-20(25)15-35)28(40)24-14-22-23(33-43-31(5,6)32(7,8)44-33)13-21(26(34)27(22)37-24)19-11-10-12-38(16-19)29(41)42-30(2,3)4/h11,13-15,37H,9-10,12,16-18,35H2,1-8H3/b20-15-,36-25- |
| InChIKey | RFDSIJLMPGEKEC-OFTANOLMSA-N |
| XLogP | 4.39 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|