C29H33N7O6 — CID 176815675
tert-butyl 2-(hydroxymethyl)-6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1-carboxylate (PubChem CID 176815675) has the molecular formula C29H33N7O6 and a molecular weight of 575.63 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 176815675 |
| Molecular Formula | C29H33N7O6 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1-carboxylate |
| SMILES | [H]/N=C/c1c(NC2CCCCO2)cc([N+](=O)[O-])cc1-c1cn(Cc2ccc3cc(CO)n(C(=O)OC(C)(C)C)c3c2)nn1 |
| InChI | InChI=1S/C29H33N7O6/c1-29(2,3)42-28(38)35-21(17-37)11-19-8-7-18(10-26(19)35)15-34-16-25(32-33-34)22-12-20(36(39)40)13-24(23(22)14-30)31-27-6-4-5-9-41-27/h7-8,10-14,16,27,30-31,37H,4-6,9,15,17H2,1-3H3/b30-14+ |
| InChIKey | RTMIAGAVHPJHLN-AMVVHIIESA-N |
| XLogP | 5.07 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|