C16H19BN2O5S — CID 176816427
5-[4-(1-aminoethylideneamino)oxolan-3-yl]sulfanyl-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid (PubChem CID 176816427) has the molecular formula C16H19BN2O5S and a molecular weight of 362.22 g/mol. Its IUPAC name is 5-[4-(1-aminoethylideneamino)oxolan-3-yl]sulfanyl-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid.
| Compound Name | 5-[4-(1-aminoethylideneamino)oxolan-3-yl]sulfanyl-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid |
|---|---|
| PubChem CID | 176816427 |
| Molecular Formula | C16H19BN2O5S |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-[4-(1-aminoethylideneamino)oxolan-3-yl]sulfanyl-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid |
| SMILES | C/C(N)=N\C1COCC1Sc1ccc2c(c1C(=O)O)OB(O)C1CC21 |
| InChI | InChI=1S/C16H19BN2O5S/c1-7(18)19-11-5-23-6-13(11)25-12-3-2-8-9-4-10(9)17(22)24-15(8)14(12)16(20)21/h2-3,9-11,13,22H,4-6H2,1H3,(H2,18,19)(H,20,21) |
| InChIKey | PAKYHSSUWMWVDX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|