C12H13BO6 — CID 140830408
(3aS,9bS)-4-hydroxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid (PubChem CID 140830408) has the molecular formula C12H13BO6 and a molecular weight of 264.04 g/mol. Its IUPAC name is (3aS,9bS)-4-hydroxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid.
| Compound Name | (3aS,9bS)-4-hydroxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid |
|---|---|
| PubChem CID | 140830408 |
| Molecular Formula | C12H13BO6 |
| Molecular Weight | 264.04 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (3aS,9bS)-4-hydroxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid |
| SMILES | COc1ccc2c(c1C(=O)O)OB(O)[C@@H]1COC[C@H]21 |
| InChI | InChI=1S/C12H13BO6/c1-17-9-3-2-6-7-4-18-5-8(7)13(16)19-11(6)10(9)12(14)15/h2-3,7-8,16H,4-5H2,1H3,(H,14,15)/t7-,8-/m1/s1 |
| InChIKey | HWOIUPRBKIQTNL-HTQZYQBOSA-N |
| XLogP | 0.75 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.04 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|