C14H16BNO7 — CID 146836612
(3R)-3-(3-formamido-2-oxopropyl)-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 146836612) has the molecular formula C14H16BNO7 and a molecular weight of 321.09 g/mol. Its IUPAC name is (3R)-3-(3-formamido-2-oxopropyl)-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(3-formamido-2-oxopropyl)-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 146836612 |
| Molecular Formula | C14H16BNO7 |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (3R)-3-(3-formamido-2-oxopropyl)-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | COc1ccc2c(c1C(=O)O)OB(O)[C@@H](CC(=O)CNC=O)C2 |
| InChI | InChI=1S/C14H16BNO7/c1-22-11-3-2-8-4-9(5-10(18)6-16-7-17)15(21)23-13(8)12(11)14(19)20/h2-3,7,9,21H,4-6H2,1H3,(H,16,17)(H,19,20)/t9-/m1/s1 |
| InChIKey | SFFVPTDWDFSTQT-SECBINFHSA-N |
| XLogP | -0.12 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|