C15H16BFO6 — CID 158806630
(3R)-3-(2,5-dioxohexyl)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 158806630) has the molecular formula C15H16BFO6 and a molecular weight of 322.10 g/mol. Its IUPAC name is (3R)-3-(2,5-dioxohexyl)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(2,5-dioxohexyl)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 158806630 |
| Molecular Formula | C15H16BFO6 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (3R)-3-(2,5-dioxohexyl)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(=O)CCC(=O)C[C@H]1Cc2ccc(F)c(C(=O)O)c2OB1O |
| InChI | InChI=1S/C15H16BFO6/c1-8(18)2-4-11(19)7-10-6-9-3-5-12(17)13(15(20)21)14(9)23-16(10)22/h3,5,10,22H,2,4,6-7H2,1H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | SJCKVUNOWUMWGJ-SNVBAGLBSA-N |
| XLogP | 1.64 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|