C10H10BFO4 — CID 142289376
7-fluoro-2-hydroxy-3-methyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142289376) has the molecular formula C10H10BFO4 and a molecular weight of 224.00 g/mol. Its IUPAC name is 7-fluoro-2-hydroxy-3-methyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 7-fluoro-2-hydroxy-3-methyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142289376 |
| Molecular Formula | C10H10BFO4 |
| Molecular Weight | 224.00 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 7-fluoro-2-hydroxy-3-methyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC1Cc2ccc(F)c(C(=O)O)c2OB1O |
| InChI | InChI=1S/C10H10BFO4/c1-5-4-6-2-3-7(12)8(10(13)14)9(6)16-11(5)15/h2-3,5,15H,4H2,1H3,(H,13,14) |
| InChIKey | KKGGKDWWWPWSKU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.00 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|