C10H10BFO5 — CID 90271836
7-fluoro-2-hydroxy-3-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 90271836) has the molecular formula C10H10BFO5 and a molecular weight of 239.99 g/mol. Its IUPAC name is 7-fluoro-2-hydroxy-3-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 7-fluoro-2-hydroxy-3-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 90271836 |
| Molecular Formula | C10H10BFO5 |
| Molecular Weight | 239.99 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 7-fluoro-2-hydroxy-3-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | COC1Cc2ccc(F)c(C(=O)O)c2OB1O |
| InChI | InChI=1S/C10H10BFO5/c1-16-7-4-5-2-3-6(12)8(10(13)14)9(5)17-11(7)15/h2-3,7,15H,4H2,1H3,(H,13,14) |
| InChIKey | XSQJSGURQRNYDW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.99 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|