C19H24BN3O7 — CID 142462348
(3R)-3-[4-(4-aminocyclohexyl)-2,5-dioxoimidazolidin-1-yl]-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142462348) has the molecular formula C19H24BN3O7 and a molecular weight of 417.23 g/mol. Its IUPAC name is (3R)-3-[4-(4-aminocyclohexyl)-2,5-dioxoimidazolidin-1-yl]-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[4-(4-aminocyclohexyl)-2,5-dioxoimidazolidin-1-yl]-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142462348 |
| Molecular Formula | C19H24BN3O7 |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (3R)-3-[4-(4-aminocyclohexyl)-2,5-dioxoimidazolidin-1-yl]-2-hydroxy-7-methoxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | COc1ccc2c(c1C(=O)O)OB(O)[C@@H](N1C(=O)NC(C3CCC(N)CC3)C1=O)C2 |
| InChI | InChI=1S/C19H24BN3O7/c1-29-12-7-4-10-8-13(20(28)30-16(10)14(12)18(25)26)23-17(24)15(22-19(23)27)9-2-5-11(21)6-3-9/h4,7,9,11,13,15,28H,2-3,5-6,8,21H2,1H3,(H,22,27)(H,25,26)/t9?,11?,13-,15?/m0/s1 |
| InChIKey | CMCHUVHJVLHTIQ-PTGRMEBYSA-N |
| XLogP | 0.15 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|