C18H22BN3O7 — CID 142462394
(3R)-2-hydroxy-7-methoxy-3-(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142462394) has the molecular formula C18H22BN3O7 and a molecular weight of 403.20 g/mol. Its IUPAC name is (3R)-2-hydroxy-7-methoxy-3-(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-7-methoxy-3-(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142462394 |
| Molecular Formula | C18H22BN3O7 |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (3R)-2-hydroxy-7-methoxy-3-(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | COc1ccc2c(c1C(=O)O)OB(O)[C@@H](N1C(=O)NC3(CCN(C)CC3)C1=O)C2 |
| InChI | InChI=1S/C18H22BN3O7/c1-21-7-5-18(6-8-21)16(25)22(17(26)20-18)12-9-10-3-4-11(28-2)13(15(23)24)14(10)29-19(12)27/h3-4,12,27H,5-9H2,1-2H3,(H,20,26)(H,23,24)/t12-/m0/s1 |
| InChIKey | WBMYZWVLCRZEQM-LBPRGKRZSA-N |
| XLogP | -0.27 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|