C39H33IrN3O2Si-2 — CID 176823271
CID 176823271 (PubChem CID 176823271) has the molecular formula C39H33IrN3O2Si-2 and a molecular weight of 805.07 g/mol.
| Compound Name | CID 176823271 |
|---|---|
| PubChem CID | 176823271 |
| Molecular Formula | C39H33IrN3O2Si-2 |
| Molecular Weight | 805.07 g/mol |
| Exact Mass | 805.25 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc2oc3ccc4oc5c(-c6cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn6)[c-]ccc5c4c3c2n1.[Ir] |
| InChI | InChI=1S/C25H17N2O2.C14H16NSi.Ir/c1-13-11-18(26-12-14(13)2)16-5-4-6-17-22-19(29-25(16)17)9-10-20-23(22)24-21(28-20)8-7-15(3)27-24;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4,6-12H,1-3H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3,2D3,3D3;; |
| InChIKey | RLAGBTHSNCFRRM-VIVYLVLJSA-N |
| XLogP | 9.76 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.07 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|