C56H54F6 — CID 176828087
1-[4-[3,5-bis(2-tert-butylphenyl)phenyl]-3,5-bis[2-(trifluoromethyl)phenyl]phenyl]adamantane (PubChem CID 176828087) has the molecular formula C56H54F6 and a molecular weight of 841.04 g/mol. Its IUPAC name is 1-[4-[3,5-bis(2-tert-butylphenyl)phenyl]-3,5-bis[2-(trifluoromethyl)phenyl]phenyl]adamantane.
| Compound Name | 1-[4-[3,5-bis(2-tert-butylphenyl)phenyl]-3,5-bis[2-(trifluoromethyl)phenyl]phenyl]adamantane |
|---|---|
| PubChem CID | 176828087 |
| Molecular Formula | C56H54F6 |
| Molecular Weight | 841.04 g/mol |
| Exact Mass | 840.41 |
| IUPAC Name | 1-[4-[3,5-bis(2-tert-butylphenyl)phenyl]-3,5-bis[2-(trifluoromethyl)phenyl]phenyl]adamantane |
| SMILES | CC(C)(C)c1ccccc1-c1cc(-c2ccccc2C(C)(C)C)cc(-c2c(-c3ccccc3C(F)(F)F)cc(C34CC5CC(CC(C5)C3)C4)cc2-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C56H54F6/c1-52(2,3)47-19-11-7-15-41(47)37-26-38(42-16-8-12-20-48(42)53(4,5)6)28-39(27-37)51-45(43-17-9-13-21-49(43)55(57,58)59)29-40(54-31-34-23-35(32-54)25-36(24-34)33-54)30-46(51)44-18-10-14-22-50(44)56(60,61)62/h7-22,26-30,34-36H,23-25,31-33H2,1-6H3 |
| InChIKey | SWDUVSDXTZCZLN-UHFFFAOYSA-N |
| XLogP | 17.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.04 |
| LogP ≤ 5 | 17.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |