C18H32ClN — CID 176829910
2-chloro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene (PubChem CID 176829910) has the molecular formula C18H32ClN and a molecular weight of 297.91 g/mol. Its IUPAC name is 2-chloro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 2-chloro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 176829910 |
| Molecular Formula | C18H32ClN |
| Molecular Weight | 297.91 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2-chloro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC(C)C1=C(C(C)C)C2(CCN(C(C)C)CC2)CC1Cl |
| InChI | InChI=1S/C18H32ClN/c1-12(2)16-15(19)11-18(17(16)13(3)4)7-9-20(10-8-18)14(5)6/h12-15H,7-11H2,1-6H3 |
| InChIKey | ZIBOZRJAHHFDQC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|