C19H35NO — CID 176830058
2-ethyl-3,4,8-tri(propan-2-yl)-1-oxa-8-azaspiro[4.5]dec-3-ene (PubChem CID 176830058) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is 2-ethyl-3,4,8-tri(propan-2-yl)-1-oxa-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 2-ethyl-3,4,8-tri(propan-2-yl)-1-oxa-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 176830058 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 2-ethyl-3,4,8-tri(propan-2-yl)-1-oxa-8-azaspiro[4.5]dec-3-ene |
| SMILES | CCC1OC2(CCN(C(C)C)CC2)C(C(C)C)=C1C(C)C |
| InChI | InChI=1S/C19H35NO/c1-8-16-17(13(2)3)18(14(4)5)19(21-16)9-11-20(12-10-19)15(6)7/h13-16H,8-12H2,1-7H3 |
| InChIKey | IBHQKACLXAGWNX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|