C20H39N — CID 177162235
ethane;4-ethyl-1-methyl-3,8-di(propan-2-yl)-8-azaspiro[4.5]dec-3-ene (PubChem CID 177162235) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is ethane;4-ethyl-1-methyl-3,8-di(propan-2-yl)-8-azaspiro[4.5]dec-3-ene.
| Compound Name | ethane;4-ethyl-1-methyl-3,8-di(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 177162235 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | ethane;4-ethyl-1-methyl-3,8-di(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC.CCC1=C(C(C)C)CC(C)C12CCN(C(C)C)CC2 |
| InChI | InChI=1S/C18H33N.C2H6/c1-7-17-16(13(2)3)12-15(6)18(17)8-10-19(11-9-18)14(4)5;1-2/h13-15H,7-12H2,1-6H3;1-2H3 |
| InChIKey | RBJCJYTZXCMCQI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|