About 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine
5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 167225931) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 167225931 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CCC1=C(C(C)C)CCN(C(C)C)C1 |
| InChI | InChI=1S/C13H25N/c1-6-12-9-14(11(4)5)8-7-13(12)10(2)3/h10-11H,6-9H2,1-5H3 |
| InChIKey | QBTZLCMKYJRUSE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine (CID 167225931) is 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine is CCC1=C(C(C)C)CCN(C(C)C)C1.
What is the InChIKey of 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is QBTZLCMKYJRUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-6-12-9-14(11(4)5)8-7-13(12)10(2)3/h10-11H,6-9H2,1-5H3.
What are the key properties of 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 195.35 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 167225931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).