About 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine
2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 122503344) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| PubChem CID | 122503344 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CCc1cc2c(s1)CCN(C(C)C)C2 |
| InChI | InChI=1S/C12H19NS/c1-4-11-7-10-8-13(9(2)3)6-5-12(10)14-11/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | NVFQEMGBYNUNJQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The IUPAC name of 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine (CID 122503344) is 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
What is the SMILES notation for 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The canonical SMILES for 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine is CCc1cc2c(s1)CCN(C(C)C)C2.
What is the InChIKey of 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The InChIKey is NVFQEMGBYNUNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS/c1-4-11-7-10-8-13(9(2)3)6-5-12(10)14-11/h7,9H,4-6,8H2,1-3H3.
What are the key properties of 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine?
2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine has a molecular weight of 209.36 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine is sourced from PubChem (CID 122503344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).