C16H18NSY- — CID 147473530
2-methyl-5-(1-phenylethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine;yttrium (PubChem CID 147473530) has the molecular formula C16H18NSY- and a molecular weight of 345.30 g/mol. Its IUPAC name is 2-methyl-5-(1-phenylethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine;yttrium.
| Compound Name | 2-methyl-5-(1-phenylethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine;yttrium |
|---|---|
| PubChem CID | 147473530 |
| Molecular Formula | C16H18NSY- |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2-methyl-5-(1-phenylethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine;yttrium |
| SMILES | Cc1cc2c(s1)CCN(C(C)c1[c-]cccc1)C2.[Y] |
| InChI | InChI=1S/C16H18NS.Y/c1-12-10-15-11-17(9-8-16(15)18-12)13(2)14-6-4-3-5-7-14;/h3-6,10,13H,8-9,11H2,1-2H3;/q-1; |
| InChIKey | PSGDAWMJPZLGRA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|