C12H23N — CID 174352136
5-ethyl-1,4-di(propan-2-yl)-2,3-dihydropyrrole (PubChem CID 174352136) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 5-ethyl-1,4-di(propan-2-yl)-2,3-dihydropyrrole.
| Compound Name | 5-ethyl-1,4-di(propan-2-yl)-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 174352136 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 5-ethyl-1,4-di(propan-2-yl)-2,3-dihydropyrrole |
| SMILES | CCC1=C(C(C)C)CCN1C(C)C |
| InChI | InChI=1S/C12H23N/c1-6-12-11(9(2)3)7-8-13(12)10(4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | SQTNFZREEMEKSI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |