C22H43N — CID 158001921
ethane;1,3,4,5,6-penta(propan-2-yl)-2H-pyridine (PubChem CID 158001921) has the molecular formula C22H43N and a molecular weight of 321.59 g/mol. Its IUPAC name is ethane;1,3,4,5,6-penta(propan-2-yl)-2H-pyridine.
| Compound Name | ethane;1,3,4,5,6-penta(propan-2-yl)-2H-pyridine |
|---|---|
| PubChem CID | 158001921 |
| Molecular Formula | C22H43N |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 321.34 |
| IUPAC Name | ethane;1,3,4,5,6-penta(propan-2-yl)-2H-pyridine |
| SMILES | CC.CC(C)C1=C(C(C)C)C(C(C)C)=C(C(C)C)N(C(C)C)C1 |
| InChI | InChI=1S/C20H37N.C2H6/c1-12(2)17-11-21(16(9)10)20(15(7)8)19(14(5)6)18(17)13(3)4;1-2/h12-16H,11H2,1-10H3;1-2H3 |
| InChIKey | FDVJWKYIUUEUBA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |