About CID 100954217
CID 100954217 (PubChem CID 100954217) has the molecular formula C20H35
and a molecular weight of 275.50 g/mol.
Molecular Properties
| Compound Name | CID 100954217 |
| PubChem CID | 100954217 |
| Molecular Formula | C20H35 |
| Molecular Weight | 275.50 g/mol |
| Exact Mass | 275.27 |
| IUPAC Name | — |
| SMILES | CC(C)[C]1C(C(C)C)=C(C(C)C)C(C(C)C)=C1C(C)C |
| InChI | InChI=1S/C20H35/c1-11(2)16-17(12(3)4)19(14(7)8)20(15(9)10)18(16)13(5)6/h11-15H,1-10H3 |
| InChIKey | QYOPTMHKVPOROI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 100954217 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100954217?
The IUPAC name of CID 100954217 (CID 100954217) is not available.
What is the SMILES notation for CID 100954217?
The canonical SMILES for CID 100954217 is CC(C)[C]1C(C(C)C)=C(C(C)C)C(C(C)C)=C1C(C)C.
What is the InChIKey of CID 100954217?
The InChIKey is QYOPTMHKVPOROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35/c1-11(2)16-17(12(3)4)19(14(7)8)20(15(9)10)18(16)13(5)6/h11-15H,1-10H3.
What are the key properties of CID 100954217?
CID 100954217 has a molecular weight of 275.50 g/mol, XLogP of 6.45, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100954217 is sourced from PubChem (CID 100954217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).