C27H20O4 — CID 176830387
9,9'-spirobi[7,8-dihydrophenalene]-1,1'-dicarboxylic acid (PubChem CID 176830387) has the molecular formula C27H20O4 and a molecular weight of 408.45 g/mol. Its IUPAC name is 9,9'-spirobi[7,8-dihydrophenalene]-1,1'-dicarboxylic acid.
| Compound Name | 9,9'-spirobi[7,8-dihydrophenalene]-1,1'-dicarboxylic acid |
|---|---|
| PubChem CID | 176830387 |
| Molecular Formula | C27H20O4 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 9,9'-spirobi[7,8-dihydrophenalene]-1,1'-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2cccc3c2c1C1(CC3)CCc2cccc3ccc(C(=O)O)c1c23 |
| InChI | InChI=1S/C27H20O4/c28-25(29)19-9-7-15-3-1-5-17-11-13-27(23(19)21(15)17)14-12-18-6-2-4-16-8-10-20(26(30)31)24(27)22(16)18/h1-10H,11-14H2,(H,28,29)(H,30,31) |
| InChIKey | AFBZKEJVFFLGJK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |