C25H40ClF2N5O4S — CID 176833209
4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-(difluoromethoxy)cyclopentanecarbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176833209) has the molecular formula C25H40ClF2N5O4S and a molecular weight of 580.14 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-(difluoromethoxy)cyclopentanecarbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-(difluoromethoxy)cyclopentanecarbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176833209 |
| Molecular Formula | C25H40ClF2N5O4S |
| Molecular Weight | 580.14 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-(difluoromethoxy)cyclopentanecarbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3CCC(OC(F)F)C3)CC2S1 |
| InChI | InChI=1S/C25H40ClF2N5O4S/c1-12-5-15(16-7-21(26)30-9-19(16)36-2)17(8-29-12)22(34)32-25-31-18-10-33(11-20(18)38-25)23(35)13-3-4-14(6-13)37-24(27)28/h12-21,24-25,29-31H,3-11H2,1-2H3,(H,32,34) |
| InChIKey | NUVZMKIZYIPZMA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|