C24H42ClN7O4S — CID 176832465
4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-methoxy-1,3-diazinane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176832465) has the molecular formula C24H42ClN7O4S and a molecular weight of 560.17 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-methoxy-1,3-diazinane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-methoxy-1,3-diazinane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176832465 |
| Molecular Formula | C24H42ClN7O4S |
| Molecular Weight | 560.17 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-methoxy-1,3-diazinane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(C(=O)N2CC3NC(NC(=O)C4CNC(C)CC4C4CC(Cl)NCC4OC)SC3C2)NC1 |
| InChI | InChI=1S/C24H42ClN7O4S/c1-12-4-14(15-5-20(25)27-9-18(15)36-3)16(8-26-12)22(33)31-24-30-17-10-32(11-19(17)37-24)23(34)21-28-6-13(35-2)7-29-21/h12-21,24,26-30H,4-11H2,1-3H3,(H,31,33) |
| InChIKey | AFQBXQKXZUMVOD-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.17 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|