C23H39Cl2N7O3S — CID 176832622
4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-chloro-2-methylpyrazolidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176832622) has the molecular formula C23H39Cl2N7O3S and a molecular weight of 564.58 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-chloro-2-methylpyrazolidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-chloro-2-methylpyrazolidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176832622 |
| Molecular Formula | C23H39Cl2N7O3S |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-(5-chloro-2-methylpyrazolidine-3-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3CC(Cl)NN3C)CC2S1 |
| InChI | InChI=1S/C23H39Cl2N7O3S/c1-11-4-12(13-5-19(24)27-8-17(13)35-3)14(7-26-11)21(33)29-23-28-15-9-32(10-18(15)36-23)22(34)16-6-20(25)30-31(16)2/h11-20,23,26-28,30H,4-10H2,1-3H3,(H,29,33) |
| InChIKey | FHIKFMKNACKVDJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|