C25H42ClF2N7O3S — CID 176834121
4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[5-(difluoromethyl)-1,3-dimethylpyrazolidine-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176834121) has the molecular formula C25H42ClF2N7O3S and a molecular weight of 594.17 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[5-(difluoromethyl)-1,3-dimethylpyrazolidine-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[5-(difluoromethyl)-1,3-dimethylpyrazolidine-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176834121 |
| Molecular Formula | C25H42ClF2N7O3S |
| Molecular Weight | 594.17 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[5-(difluoromethyl)-1,3-dimethylpyrazolidine-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3C(C)NN(C)C3C(F)F)CC2S1 |
| InChI | InChI=1S/C25H42ClF2N7O3S/c1-11-5-13(14-6-19(26)30-8-17(14)38-4)15(7-29-11)23(36)32-25-31-16-9-35(10-18(16)39-25)24(37)20-12(2)33-34(3)21(20)22(27)28/h11-22,25,29-31,33H,5-10H2,1-4H3,(H,32,36) |
| InChIKey | GTFQBRAMYMPFCK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|