C24H42ClN7O3S — CID 176832594
4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(5-methylpiperazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide (PubChem CID 176832594) has the molecular formula C24H42ClN7O3S and a molecular weight of 544.17 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(5-methylpiperazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(5-methylpiperazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 176832594 |
| Molecular Formula | C24H42ClN7O3S |
| Molecular Weight | 544.17 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(5-methylpiperazine-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3CNC(C)CN3)CC2S1 |
| InChI | InChI=1S/C24H42ClN7O3S/c1-12-4-14(15-5-21(25)29-9-19(15)35-3)16(7-26-12)22(33)31-24-30-18-10-32(11-20(18)36-24)23(34)17-8-27-13(2)6-28-17/h12-21,24,26-30H,4-11H2,1-3H3,(H,31,33) |
| InChIKey | FNWTXJZFYUROCY-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.17 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|