C18H22FNO5 — CID 176835304
1-O-benzyl 2-O-methyl (4R)-4-fluoro-2-[2-(oxiran-2-yl)ethyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 176835304) has the molecular formula C18H22FNO5 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (4R)-4-fluoro-2-[2-(oxiran-2-yl)ethyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (4R)-4-fluoro-2-[2-(oxiran-2-yl)ethyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 176835304 |
| Molecular Formula | C18H22FNO5 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (4R)-4-fluoro-2-[2-(oxiran-2-yl)ethyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1(CCC2CO2)C[C@@H](F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22FNO5/c1-23-16(21)18(8-7-15-12-24-15)9-14(19)10-20(18)17(22)25-11-13-5-3-2-4-6-13/h2-6,14-15H,7-12H2,1H3/t14-,15?,18?/m1/s1 |
| InChIKey | RVRBEGSZCCPZKH-KSTDHSDQSA-N |
| XLogP | 2.46 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|