C16H18F3NO5 — CID 12968946
methyl 4-(oxiran-2-yl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)butanoate (PubChem CID 12968946) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is methyl 4-(oxiran-2-yl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)butanoate.
| Compound Name | methyl 4-(oxiran-2-yl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 12968946 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl 4-(oxiran-2-yl)-2-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)butanoate |
| SMILES | COC(=O)C(CCC1CO1)(NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO5/c1-23-13(21)15(16(17,18)19,8-7-12-10-24-12)20-14(22)25-9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,20,22) |
| InChIKey | TXZYDAIMTNGWTP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|