About tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate
tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate (PubChem CID 155595544) has the molecular formula C17H21F2NO4
and a molecular weight of 341.35 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate |
| PubChem CID | 155595544 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(NC(=O)OCc2ccccc2)CC(F)(F)C1 |
| InChI | InChI=1S/C17H21F2NO4/c1-15(2,3)24-13(21)16(10-17(18,19)11-16)20-14(22)23-9-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,20,22) |
| InChIKey | AHSWGWOITTYODA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
The IUPAC name of tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate (CID 155595544) is tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate.
What is the SMILES notation for tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
The canonical SMILES for tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate is CC(C)(C)OC(=O)C1(NC(=O)OCc2ccccc2)CC(F)(F)C1.
What is the InChIKey of tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
The InChIKey is AHSWGWOITTYODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO4/c1-15(2,3)24-13(21)16(10-17(18,19)11-16)20-14(22)23-9-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,20,22).
What are the key properties of tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate?
tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate has a molecular weight of 341.35 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3-difluoro-1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylate is sourced from PubChem (CID 155595544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).