C12H16N4 — CID 176836936
12-tert-butyl-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 176836936) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 12-tert-butyl-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 12-tert-butyl-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 176836936 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 12-tert-butyl-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | CC(C)(C)c1nnc2cc3c(nn12)CCC3 |
| InChI | InChI=1S/C12H16N4/c1-12(2,3)11-14-13-10-7-8-5-4-6-9(8)15-16(10)11/h7H,4-6H2,1-3H3 |
| InChIKey | PVGAMIRWULQGFZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |