C12H20O6 — CID 176837340
(2S)-3-hydroxy-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanal (PubChem CID 176837340) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanal.
| Compound Name | (2S)-3-hydroxy-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanal |
|---|---|
| PubChem CID | 176837340 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2S)-3-hydroxy-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanal |
| SMILES | C#CCOCCOCCOCCO[C@H](C=O)CO |
| InChI | InChI=1S/C12H20O6/c1-2-3-15-4-5-16-6-7-17-8-9-18-12(10-13)11-14/h1,10,12,14H,3-9,11H2/t12-/m1/s1 |
| InChIKey | FYPGRLNBJCKXMT-GFCCVEGCSA-N |
| XLogP | -0.75 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|