C25H44O11 — CID 176837312
(2S,3R,4R,5S)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-5-[5-(2-prop-2-ynoxyethoxy)pentoxy]hexane-1,3,4,6-tetrol (PubChem CID 176837312) has the molecular formula C25H44O11 and a molecular weight of 520.62 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-5-[5-(2-prop-2-ynoxyethoxy)pentoxy]hexane-1,3,4,6-tetrol.
| Compound Name | (2S,3R,4R,5S)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-5-[5-(2-prop-2-ynoxyethoxy)pentoxy]hexane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 176837312 |
| Molecular Formula | C25H44O11 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | (2S,3R,4R,5S)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-5-[5-(2-prop-2-ynoxyethoxy)pentoxy]hexane-1,3,4,6-tetrol |
| SMILES | C#CCOCCOCCCCCO[C@@H](CO)[C@H](O)[C@@H](O)[C@H](CO)OCCOCCOCCOCC#C |
| InChI | InChI=1S/C25H44O11/c1-3-8-30-12-14-32-10-6-5-7-11-35-22(20-26)24(28)25(29)23(21-27)36-19-18-34-17-16-33-15-13-31-9-4-2/h1-2,22-29H,5-21H2/t22-,23-,24-,25-/m0/s1 |
| InChIKey | UXWZHRXGIVXUQU-QORCZRPOSA-N |
| XLogP | -1.02 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|