C18H36O5S2 — CID 176837948
2-[2-(2-butoxyethoxy)ethoxy]ethyl 6,8-bis(sulfanyl)octanoate (PubChem CID 176837948) has the molecular formula C18H36O5S2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethoxy]ethyl 6,8-bis(sulfanyl)octanoate.
| Compound Name | 2-[2-(2-butoxyethoxy)ethoxy]ethyl 6,8-bis(sulfanyl)octanoate |
|---|---|
| PubChem CID | 176837948 |
| Molecular Formula | C18H36O5S2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethoxy]ethyl 6,8-bis(sulfanyl)octanoate |
| SMILES | CCCCOCCOCCOCCOC(=O)CCCCC(S)CCS |
| InChI | InChI=1S/C18H36O5S2/c1-2-3-9-20-10-11-21-12-13-22-14-15-23-18(19)7-5-4-6-17(25)8-16-24/h17,24-25H,2-16H2,1H3 |
| InChIKey | CFRWFTJMKFKLQC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|