C26H46O6S2 — CID 139249337
2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl 6,8-bis(sulfanyl)octanoate (PubChem CID 139249337) has the molecular formula C26H46O6S2 and a molecular weight of 518.78 g/mol. Its IUPAC name is 2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl 6,8-bis(sulfanyl)octanoate.
| Compound Name | 2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl 6,8-bis(sulfanyl)octanoate |
|---|---|
| PubChem CID | 139249337 |
| Molecular Formula | C26H46O6S2 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl 6,8-bis(sulfanyl)octanoate |
| SMILES | O=C(CCCCC(S)CCS)OCCOCCOCCOCCOC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H46O6S2/c27-25(4-2-1-3-24(34)5-14-33)31-12-10-29-8-6-28-7-9-30-11-13-32-26-18-21-15-22(19-26)17-23(16-21)20-26/h21-24,33-34H,1-20H2 |
| InChIKey | GNEWHRZIZTXHQK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|