C12H25NO2S2 — CID 23298470
2-(dimethylamino)ethyl 6,8-bis(sulfanyl)octanoate (PubChem CID 23298470) has the molecular formula C12H25NO2S2 and a molecular weight of 279.47 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 6,8-bis(sulfanyl)octanoate.
| Compound Name | 2-(dimethylamino)ethyl 6,8-bis(sulfanyl)octanoate |
|---|---|
| PubChem CID | 23298470 |
| Molecular Formula | C12H25NO2S2 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(dimethylamino)ethyl 6,8-bis(sulfanyl)octanoate |
| SMILES | CN(C)CCOC(=O)CCCCC(S)CCS |
| InChI | InChI=1S/C12H25NO2S2/c1-13(2)8-9-15-12(14)6-4-3-5-11(17)7-10-16/h11,16-17H,3-10H2,1-2H3 |
| InChIKey | MFQIKXBWXJHULE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|