C16H32N2O3S2 — CID 155224123
2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl (6R)-6,8-bis(sulfanyl)octanoate (PubChem CID 155224123) has the molecular formula C16H32N2O3S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl (6R)-6,8-bis(sulfanyl)octanoate.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl (6R)-6,8-bis(sulfanyl)octanoate |
|---|---|
| PubChem CID | 155224123 |
| Molecular Formula | C16H32N2O3S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl (6R)-6,8-bis(sulfanyl)octanoate |
| SMILES | O=C(CCCC[C@@H](S)CCS)OCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H32N2O3S2/c19-12-10-17-6-8-18(9-7-17)11-13-21-16(20)4-2-1-3-15(23)5-14-22/h15,19,22-23H,1-14H2/t15-/m1/s1 |
| InChIKey | HMUZWEZGORBBMA-OAHLLOKOSA-N |
| XLogP | 1.32 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|