C30H25ClFN5O5S — CID 176838414
prop-2-enyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(6-methyl-5-phenyl-1,2,4-triazin-3-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 176838414) has the molecular formula C30H25ClFN5O5S and a molecular weight of 622.08 g/mol. Its IUPAC name is prop-2-enyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(6-methyl-5-phenyl-1,2,4-triazin-3-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(6-methyl-5-phenyl-1,2,4-triazin-3-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 176838414 |
| Molecular Formula | C30H25ClFN5O5S |
| Molecular Weight | 622.08 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | prop-2-enyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(6-methyl-5-phenyl-1,2,4-triazin-3-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H]1CS(=O)(=O)c2cc(F)c(-c3nnc(C)c(-c4ccccc4)n3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C30H25ClFN5O5S/c1-3-13-42-30(39)33-24-17-43(40,41)26-15-23(32)22(28-34-27(18(2)35-36-28)20-7-5-4-6-8-20)14-25(26)37(29(24)38)16-19-9-11-21(31)12-10-19/h3-12,14-15,24H,1,13,16-17H2,2H3,(H,33,39)/t24-/m0/s1 |
| InChIKey | URMPUMUSQPBLQD-DEOSSOPVSA-N |
| XLogP | 4.91 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.08 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|