C10H19FO — CID 176842695
4-fluoro-2,7-dimethyloctan-3-one (PubChem CID 176842695) has the molecular formula C10H19FO and a molecular weight of 174.26 g/mol. Its IUPAC name is 4-fluoro-2,7-dimethyloctan-3-one.
| Compound Name | 4-fluoro-2,7-dimethyloctan-3-one |
|---|---|
| PubChem CID | 176842695 |
| Molecular Formula | C10H19FO |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 4-fluoro-2,7-dimethyloctan-3-one |
| SMILES | CC(C)CCC(F)C(=O)C(C)C |
| InChI | InChI=1S/C10H19FO/c1-7(2)5-6-9(11)10(12)8(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | GPBVHQUHGRHVAA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |