C29H23ClN7OOs — CID 176846052
3-(4-methyl-2-pyridinyl)benzene-4-ide-1-carbonyl chloride;osmium(1+);bis(2-pyrazol-1-ylpyridine) (PubChem CID 176846052) has the molecular formula C29H23ClN7OOs and a molecular weight of 711.23 g/mol. Its IUPAC name is 3-(4-methyl-2-pyridinyl)benzene-4-ide-1-carbonyl chloride;osmium(1+);bis(2-pyrazol-1-ylpyridine).
| Compound Name | 3-(4-methyl-2-pyridinyl)benzene-4-ide-1-carbonyl chloride;osmium(1+);bis(2-pyrazol-1-ylpyridine) |
|---|---|
| PubChem CID | 176846052 |
| Molecular Formula | C29H23ClN7OOs |
| Molecular Weight | 711.23 g/mol |
| Exact Mass | 712.13 |
| IUPAC Name | 3-(4-methyl-2-pyridinyl)benzene-4-ide-1-carbonyl chloride;osmium(1+);bis(2-pyrazol-1-ylpyridine) |
| SMILES | Cc1ccnc(-c2[c-]ccc(C(=O)Cl)c2)c1.[Os+].c1ccc(-n2cccn2)nc1.c1ccc(-n2cccn2)nc1 |
| InChI | InChI=1S/C13H9ClNO.2C8H7N3.Os/c1-9-5-6-15-12(7-9)10-3-2-4-11(8-10)13(14)16;2*1-2-5-9-8(4-1)11-7-3-6-10-11;/h2,4-8H,1H3;2*1-7H;/q-1;;;+1 |
| InChIKey | CIZQYQUBLLUHGW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|