C14H24N5+ — CID 176846057
2-[3-(4-imidazol-1-ylhexan-2-yl)imidazol-1-ium-1-yl]ethanamine (PubChem CID 176846057) has the molecular formula C14H24N5+ and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-[3-(4-imidazol-1-ylhexan-2-yl)imidazol-1-ium-1-yl]ethanamine.
| Compound Name | 2-[3-(4-imidazol-1-ylhexan-2-yl)imidazol-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 176846057 |
| Molecular Formula | C14H24N5+ |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-[3-(4-imidazol-1-ylhexan-2-yl)imidazol-1-ium-1-yl]ethanamine |
| SMILES | CCC(CC(C)n1cc[n+](CCN)c1)n1ccnc1 |
| InChI | InChI=1S/C14H24N5/c1-3-14(18-7-5-16-11-18)10-13(2)19-9-8-17(12-19)6-4-15/h5,7-9,11-14H,3-4,6,10,15H2,1-2H3/q+1 |
| InChIKey | IGXJVNPAMYKISG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|