C31H46N10O2 — CID 176729128
N-[[[4,6-di(imidazol-1-yl)-2-methyloctanoyl]amino]methyl]-4,6-di(imidazol-1-yl)-2-methyloctanamide (PubChem CID 176729128) has the molecular formula C31H46N10O2 and a molecular weight of 590.78 g/mol. Its IUPAC name is N-[[[4,6-di(imidazol-1-yl)-2-methyloctanoyl]amino]methyl]-4,6-di(imidazol-1-yl)-2-methyloctanamide.
| Compound Name | N-[[[4,6-di(imidazol-1-yl)-2-methyloctanoyl]amino]methyl]-4,6-di(imidazol-1-yl)-2-methyloctanamide |
|---|---|
| PubChem CID | 176729128 |
| Molecular Formula | C31H46N10O2 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | N-[[[4,6-di(imidazol-1-yl)-2-methyloctanoyl]amino]methyl]-4,6-di(imidazol-1-yl)-2-methyloctanamide |
| SMILES | CCC(CC(CC(C)C(=O)NCNC(=O)C(C)CC(CC(CC)n1ccnc1)n1ccnc1)n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C31H46N10O2/c1-5-26(38-11-7-32-20-38)17-28(40-13-9-34-22-40)15-24(3)30(42)36-19-37-31(43)25(4)16-29(41-14-10-35-23-41)18-27(6-2)39-12-8-33-21-39/h7-14,20-29H,5-6,15-19H2,1-4H3,(H,36,42)(H,37,43) |
| InChIKey | BDKDLHXBFVKFDL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|