C33H29BFN3O2 — CID 176849697
2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 176849697) has the molecular formula C33H29BFN3O2 and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176849697 |
| Molecular Formula | C33H29BFN3O2 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(F)c(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccccc5)c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C33H29BFN3O2/c1-32(2)33(3,4)40-34(39-32)26-18-19-28(35)27(21-26)31-37-29(23-14-9-6-10-15-23)36-30(38-31)25-17-11-16-24(20-25)22-12-7-5-8-13-22/h5-21H,1-4H3 |
| InChIKey | JPGOUEDWFVEUIN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|